C11H18N5O6PS — CID 130355888
(1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-dihydroxyphosphinothioyloxy-3-hydroxypropan-2-yl]oxypropan-2-ol (PubChem CID 130355888) has the molecular formula C11H18N5O6PS and a molecular weight of 379.34 g/mol. Its IUPAC name is (1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-dihydroxyphosphinothioyloxy-3-hydroxypropan-2-yl]oxypropan-2-ol.
| Compound Name | (1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-dihydroxyphosphinothioyloxy-3-hydroxypropan-2-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 130355888 |
| Molecular Formula | C11H18N5O6PS |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-dihydroxyphosphinothioyloxy-3-hydroxypropan-2-yl]oxypropan-2-ol |
| SMILES | C[C@H](O)[C@@H](O[C@@H](CO)COP(O)(O)=S)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H18N5O6PS/c1-6(18)11(22-7(2-17)3-21-23(19,20)24)16-5-15-8-9(12)13-4-14-10(8)16/h4-7,11,17-18H,2-3H2,1H3,(H2,12,13,14)(H2,19,20,24)/t6-,7-,11+/m0/s1 |
| InChIKey | ZTKBPWXUYZLQIX-OKTBNZSVSA-N |
| XLogP | -1.11 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|