C12H19N5O3 — CID 171447656
(2R)-2-[(1R)-1-(6-aminopurin-9-yl)-2-methoxyethoxy]butan-1-ol (PubChem CID 171447656) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-(6-aminopurin-9-yl)-2-methoxyethoxy]butan-1-ol.
| Compound Name | (2R)-2-[(1R)-1-(6-aminopurin-9-yl)-2-methoxyethoxy]butan-1-ol |
|---|---|
| PubChem CID | 171447656 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2R)-2-[(1R)-1-(6-aminopurin-9-yl)-2-methoxyethoxy]butan-1-ol |
| SMILES | CC[C@H](CO)O[C@H](COC)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H19N5O3/c1-3-8(4-18)20-9(5-19-2)17-7-16-10-11(13)14-6-15-12(10)17/h6-9,18H,3-5H2,1-2H3,(H2,13,14,15)/t8-,9-/m1/s1 |
| InChIKey | KBYDLZLMSPRTBI-RKDXNWHRSA-N |
| XLogP | 0.34 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |