C25H25N5O5 — CID 70904333
[(2R)-2-(6-benzamidopurin-9-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate (PubChem CID 70904333) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is [(2R)-2-(6-benzamidopurin-9-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate.
| Compound Name | [(2R)-2-(6-benzamidopurin-9-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate |
|---|---|
| PubChem CID | 70904333 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [(2R)-2-(6-benzamidopurin-9-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate |
| SMILES | CC[C@H](CO)O[C@H](COC(=O)c1ccccc1)n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C25H25N5O5/c1-2-19(13-31)35-20(14-34-25(33)18-11-7-4-8-12-18)30-16-28-21-22(26-15-27-23(21)30)29-24(32)17-9-5-3-6-10-17/h3-12,15-16,19-20,31H,2,13-14H2,1H3,(H,26,27,29,32)/t19-,20-/m1/s1 |
| InChIKey | YPOGMASDXYVLCJ-WOJBJXKFSA-N |
| XLogP | 3.22 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |