C34H35N7O6 — CID 159197487
[(2R)-2-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate (PubChem CID 159197487) has the molecular formula C34H35N7O6 and a molecular weight of 637.70 g/mol. Its IUPAC name is [(2R)-2-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate.
| Compound Name | [(2R)-2-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate |
|---|---|
| PubChem CID | 159197487 |
| Molecular Formula | C34H35N7O6 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | [(2R)-2-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate |
| SMILES | CC[C@H](CO)O[C@H](COC(=O)c1ccccc1)n1cnc2c(N=CN(C)C)nc(OC(=O)N(c3ccccc3)c3ccccc3)nc21 |
| InChI | InChI=1S/C34H35N7O6/c1-4-27(20-42)46-28(21-45-32(43)24-14-8-5-9-15-24)40-23-35-29-30(36-22-39(2)3)37-33(38-31(29)40)47-34(44)41(25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,22-23,27-28,42H,4,20-21H2,1-3H3/t27-,28-/m1/s1 |
| InChIKey | GXIXZQGKZFEZOP-VSGBNLITSA-N |
| XLogP | 5.53 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|