C30H34N8O5 — CID 162115442
[(2R)-1-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]butan-2-yl] 4-(methylamino)-4-oxobutanoate (PubChem CID 162115442) has the molecular formula C30H34N8O5 and a molecular weight of 586.65 g/mol. Its IUPAC name is [(2R)-1-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]butan-2-yl] 4-(methylamino)-4-oxobutanoate.
| Compound Name | [(2R)-1-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]butan-2-yl] 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 162115442 |
| Molecular Formula | C30H34N8O5 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [(2R)-1-[6-(dimethylaminomethylideneamino)-2-(diphenylcarbamoyloxy)purin-9-yl]butan-2-yl] 4-(methylamino)-4-oxobutanoate |
| SMILES | CC[C@H](Cn1cnc2c(N=CN(C)C)nc(OC(=O)N(c3ccccc3)c3ccccc3)nc21)OC(=O)CCC(=O)NC |
| InChI | InChI=1S/C30H34N8O5/c1-5-23(42-25(40)17-16-24(39)31-2)18-37-20-32-26-27(33-19-36(3)4)34-29(35-28(26)37)43-30(41)38(21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,19-20,23H,5,16-18H2,1-4H3,(H,31,39)/t23-/m1/s1 |
| InChIKey | FWQJOHHUHNDDNN-HSZRJFAPSA-N |
| XLogP | 4.23 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|