C23H21N7O4 — CID 162459056
[6-[(E)-dimethylaminomethylideneamino]-2-(diphenylcarbamoyloxy)purin-9-yl]methyl formate (PubChem CID 162459056) has the molecular formula C23H21N7O4 and a molecular weight of 459.47 g/mol. Its IUPAC name is [6-[(E)-dimethylaminomethylideneamino]-2-(diphenylcarbamoyloxy)purin-9-yl]methyl formate.
| Compound Name | [6-[(E)-dimethylaminomethylideneamino]-2-(diphenylcarbamoyloxy)purin-9-yl]methyl formate |
|---|---|
| PubChem CID | 162459056 |
| Molecular Formula | C23H21N7O4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [6-[(E)-dimethylaminomethylideneamino]-2-(diphenylcarbamoyloxy)purin-9-yl]methyl formate |
| SMILES | CN(C)/C=N/c1nc(OC(=O)N(c2ccccc2)c2ccccc2)nc2c1ncn2COC=O |
| InChI | InChI=1S/C23H21N7O4/c1-28(2)13-25-20-19-21(29(14-24-19)15-33-16-31)27-22(26-20)34-23(32)30(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14,16H,15H2,1-2H3/b25-13+ |
| InChIKey | FBKBWMTWWMHALP-DHRITJCHSA-N |
| XLogP | 3.52 |
| TPSA | 115.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|