C27H29N7O5 — CID 177423574
[6-[(E)-1-(dimethylamino)ethylideneamino]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] N,N-diphenylcarbamate (PubChem CID 177423574) has the molecular formula C27H29N7O5 and a molecular weight of 531.57 g/mol. Its IUPAC name is [6-[(E)-1-(dimethylamino)ethylideneamino]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] N,N-diphenylcarbamate.
| Compound Name | [6-[(E)-1-(dimethylamino)ethylideneamino]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 177423574 |
| Molecular Formula | C27H29N7O5 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | [6-[(E)-1-(dimethylamino)ethylideneamino]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl] N,N-diphenylcarbamate |
| SMILES | C/C(=N\c1nc(OC(=O)N(c2ccccc2)c2ccccc2)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1)N(C)C |
| InChI | InChI=1S/C27H29N7O5/c1-17(32(2)3)29-24-23-25(33(16-28-23)22-14-20(36)21(15-35)38-22)31-26(30-24)39-27(37)34(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,16,20-22,35-36H,14-15H2,1-3H3/b29-17+/t20-,21+,22+/m0/s1 |
| InChIKey | RDXLYGQHKGRAGJ-MOKMLSMASA-N |
| XLogP | 3.42 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|