C17H21N7O3 — CID 10044722
[6-[4-(dimethylamino)pyridin-1-ium-1-yl]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]azanide (PubChem CID 10044722) has the molecular formula C17H21N7O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is [6-[4-(dimethylamino)pyridin-1-ium-1-yl]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]azanide.
| Compound Name | [6-[4-(dimethylamino)pyridin-1-ium-1-yl]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]azanide |
|---|---|
| PubChem CID | 10044722 |
| Molecular Formula | C17H21N7O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [6-[4-(dimethylamino)pyridin-1-ium-1-yl]-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]azanide |
| SMILES | CN(C)c1cc[n+](-c2nc([NH-])nc3c2ncn3[C@H]2C[C@H](O)[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C17H21N7O3/c1-22(2)10-3-5-23(6-4-10)15-14-16(21-17(18)20-15)24(9-19-14)13-7-11(26)12(8-25)27-13/h3-6,9,11-13,25-26H,7-8H2,1-2H3,(H-,18,20,21)/t11-,12+,13+/m0/s1 |
| InChIKey | VNUVREDCELTEHH-YNEHKIRRSA-N |
| XLogP | 0.49 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|