C46H36N6O10 — CID 134929688
[(2R,3R,4R,5R)-5-[6-acetamido-2-(diphenylcarbamoyloxy)purin-9-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 134929688) has the molecular formula C46H36N6O10 and a molecular weight of 832.83 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[6-acetamido-2-(diphenylcarbamoyloxy)purin-9-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-[6-acetamido-2-(diphenylcarbamoyloxy)purin-9-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134929688 |
| Molecular Formula | C46H36N6O10 |
| Molecular Weight | 832.83 g/mol |
| Exact Mass | 832.25 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[6-acetamido-2-(diphenylcarbamoyloxy)purin-9-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)Nc1nc(OC(=O)N(c2ccccc2)c2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C46H36N6O10/c1-29(53)48-39-36-40(50-45(49-39)62-46(57)52(33-23-13-5-14-24-33)34-25-15-6-16-26-34)51(28-47-36)41-38(61-44(56)32-21-11-4-12-22-32)37(60-43(55)31-19-9-3-10-20-31)35(59-41)27-58-42(54)30-17-7-2-8-18-30/h2-26,28,35,37-38,41H,27H2,1H3,(H,48,49,50,53)/t35-,37-,38-,41-/m1/s1 |
| InChIKey | RMESVDYSISBNAO-LSZAAVILSA-N |
| XLogP | 7.33 |
| TPSA | 190.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.83 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|