C19H28N6O4 — CID 160907116
[(2R)-1-[2-(dimethylaminomethylideneamino)-1-methyl-6-oxopurin-9-yl]butan-2-yl] 4-oxohexanoate (PubChem CID 160907116) has the molecular formula C19H28N6O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is [(2R)-1-[2-(dimethylaminomethylideneamino)-1-methyl-6-oxopurin-9-yl]butan-2-yl] 4-oxohexanoate.
| Compound Name | [(2R)-1-[2-(dimethylaminomethylideneamino)-1-methyl-6-oxopurin-9-yl]butan-2-yl] 4-oxohexanoate |
|---|---|
| PubChem CID | 160907116 |
| Molecular Formula | C19H28N6O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [(2R)-1-[2-(dimethylaminomethylideneamino)-1-methyl-6-oxopurin-9-yl]butan-2-yl] 4-oxohexanoate |
| SMILES | CCC(=O)CCC(=O)O[C@H](CC)Cn1cnc2c(=O)n(C)c(N=CN(C)C)nc21 |
| InChI | InChI=1S/C19H28N6O4/c1-6-13(26)8-9-15(27)29-14(7-2)10-25-12-20-16-17(25)22-19(21-11-23(3)4)24(5)18(16)28/h11-12,14H,6-10H2,1-5H3/t14-/m1/s1 |
| InChIKey | IUCYSPSPMZNDQG-CQSZACIVSA-N |
| XLogP | 1.43 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|