C8H10N4O — CID 59886903
1,2,9-trimethylpurin-6-one (PubChem CID 59886903) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 1,2,9-trimethylpurin-6-one.
| Compound Name | 1,2,9-trimethylpurin-6-one |
|---|---|
| PubChem CID | 59886903 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 1,2,9-trimethylpurin-6-one |
| SMILES | Cc1nc2c(ncn2C)c(=O)n1C |
| InChI | InChI=1S/C8H10N4O/c1-5-10-7-6(8(13)12(5)3)9-4-11(7)2/h4H,1-3H3 |
| InChIKey | JAHCXKHESDTURJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |