C6H8N6O — CID 119097345
1,2-diamino-9-methylpurin-6-one (PubChem CID 119097345) has the molecular formula C6H8N6O and a molecular weight of 180.17 g/mol. Its IUPAC name is 1,2-diamino-9-methylpurin-6-one.
| Compound Name | 1,2-diamino-9-methylpurin-6-one |
|---|---|
| PubChem CID | 119097345 |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1,2-diamino-9-methylpurin-6-one |
| SMILES | Cn1cnc2c(=O)n(N)c(N)nc21 |
| InChI | InChI=1S/C6H8N6O/c1-11-2-9-3-4(11)10-6(7)12(8)5(3)13/h2H,8H2,1H3,(H2,7,10) |
| InChIKey | QCRHWCVJDDGIEB-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |