C7H7IN4O — CID 142107927
1-iodo-2,9-dimethylpurin-6-one (PubChem CID 142107927) has the molecular formula C7H7IN4O and a molecular weight of 290.06 g/mol. Its IUPAC name is 1-iodo-2,9-dimethylpurin-6-one.
| Compound Name | 1-iodo-2,9-dimethylpurin-6-one |
|---|---|
| PubChem CID | 142107927 |
| Molecular Formula | C7H7IN4O |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 1-iodo-2,9-dimethylpurin-6-one |
| SMILES | Cc1nc2c(ncn2C)c(=O)n1I |
| InChI | InChI=1S/C7H7IN4O/c1-4-10-6-5(7(13)12(4)8)9-3-11(6)2/h3H,1-2H3 |
| InChIKey | VEPPPYHDQSTRFF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|