C3H4ClNO2 — CID 172854973
1-methylaziridine-2,3-dione;hydrochloride (PubChem CID 172854973) has the molecular formula C3H4ClNO2 and a molecular weight of 121.52 g/mol. Its IUPAC name is 1-methylaziridine-2,3-dione;hydrochloride.
| Compound Name | 1-methylaziridine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 172854973 |
| Molecular Formula | C3H4ClNO2 |
| Molecular Weight | 121.52 g/mol |
| Exact Mass | 120.99 |
| IUPAC Name | 1-methylaziridine-2,3-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c1=O |
| InChI | InChI=1S/C3H3NO2.ClH/c1-4-2(5)3(4)6;/h1H3;1H |
| InChIKey | YOOFHTFRBKQYJX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.52 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|