C6H6ClN3O2 — CID 177234106
6-chloro-2,3-dimethyl-5-nitrosopyrimidin-4-one (PubChem CID 177234106) has the molecular formula C6H6ClN3O2 and a molecular weight of 187.59 g/mol. Its IUPAC name is 6-chloro-2,3-dimethyl-5-nitrosopyrimidin-4-one.
| Compound Name | 6-chloro-2,3-dimethyl-5-nitrosopyrimidin-4-one |
|---|---|
| PubChem CID | 177234106 |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | 6-chloro-2,3-dimethyl-5-nitrosopyrimidin-4-one |
| SMILES | Cc1nc(Cl)c(N=O)c(=O)n1C |
| InChI | InChI=1S/C6H6ClN3O2/c1-3-8-5(7)4(9-12)6(11)10(3)2/h1-2H3 |
| InChIKey | ZCFQRRVCOWUXJU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |