C16H24N4O3 — CID 159572703
1,3,5,6-tetramethylpyrimidine-2,4-dione;2,3,5,6-tetramethylpyrimidin-4-one (PubChem CID 159572703) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1,3,5,6-tetramethylpyrimidine-2,4-dione;2,3,5,6-tetramethylpyrimidin-4-one.
| Compound Name | 1,3,5,6-tetramethylpyrimidine-2,4-dione;2,3,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 159572703 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1,3,5,6-tetramethylpyrimidine-2,4-dione;2,3,5,6-tetramethylpyrimidin-4-one |
| SMILES | Cc1c(C)n(C)c(=O)n(C)c1=O.Cc1nc(C)n(C)c(=O)c1C |
| InChI | InChI=1S/C8H12N2O2.C8H12N2O/c1-5-6(2)9(3)8(12)10(4)7(5)11;1-5-6(2)9-7(3)10(4)8(5)11/h1-4H3;1-4H3 |
| InChIKey | MIAFJVGLUBCLQJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |