C10H12N2OS — CID 59961681
2,3,5,7-tetramethylthieno[3,4-d]pyrimidin-4-one (PubChem CID 59961681) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 2,3,5,7-tetramethylthieno[3,4-d]pyrimidin-4-one.
| Compound Name | 2,3,5,7-tetramethylthieno[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59961681 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,3,5,7-tetramethylthieno[3,4-d]pyrimidin-4-one |
| SMILES | Cc1sc(C)c2c(=O)n(C)c(C)nc12 |
| InChI | InChI=1S/C10H12N2OS/c1-5-8-9(6(2)14-5)11-7(3)12(4)10(8)13/h1-4H3 |
| InChIKey | LVAMRJJGSPXIOU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |