C8H8N2OS — CID 59961683
2,3-dimethylthieno[3,4-d]pyrimidin-4-one (PubChem CID 59961683) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 2,3-dimethylthieno[3,4-d]pyrimidin-4-one.
| Compound Name | 2,3-dimethylthieno[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59961683 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2,3-dimethylthieno[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2cscc2c(=O)n1C |
| InChI | InChI=1S/C8H8N2OS/c1-5-9-7-4-12-3-6(7)8(11)10(5)2/h3-4H,1-2H3 |
| InChIKey | JLQGJWYXWCYSCZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |