C14H16N2O3 — CID 170904363
ethyl 2,3,7-trimethyl-4-oxoquinazoline-6-carboxylate (PubChem CID 170904363) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl 2,3,7-trimethyl-4-oxoquinazoline-6-carboxylate.
| Compound Name | ethyl 2,3,7-trimethyl-4-oxoquinazoline-6-carboxylate |
|---|---|
| PubChem CID | 170904363 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | ethyl 2,3,7-trimethyl-4-oxoquinazoline-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n(C)c(C)nc2cc1C |
| InChI | InChI=1S/C14H16N2O3/c1-5-19-14(18)10-7-11-12(6-8(10)2)15-9(3)16(4)13(11)17/h6-7H,5H2,1-4H3 |
| InChIKey | BFOVLFJSRQLCRK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |