About ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate
ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate (PubChem CID 169147097) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate.
Analyze ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate?
The IUPAC name of ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate (CID 169147097) is ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate.
What is the SMILES notation for ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate?
The canonical SMILES for ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate is CCOC(=O)c1cc2cnnc(C)c2n(C)c1=O.
What is the InChIKey of ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate?
The InChIKey is MEEWRFQYYCECMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c1-4-18-12(17)9-5-8-6-13-14-7(2)10(8)15(3)11(9)16/h5-6H,4H2,1-3H3.
What are the key properties of ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate?
ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate has a molecular weight of 247.25 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,8-dimethyl-2-oxopyrido[2,3-d]pyridazine-3-carboxylate is sourced from PubChem (CID 169147097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).