C19H21N3O2 — CID 166312387
2,3-dimethyl-6-[4-[2-(methylamino)ethoxy]phenyl]quinazolin-4-one (PubChem CID 166312387) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2,3-dimethyl-6-[4-[2-(methylamino)ethoxy]phenyl]quinazolin-4-one.
| Compound Name | 2,3-dimethyl-6-[4-[2-(methylamino)ethoxy]phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 166312387 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2,3-dimethyl-6-[4-[2-(methylamino)ethoxy]phenyl]quinazolin-4-one |
| SMILES | CNCCOc1ccc(-c2ccc3nc(C)n(C)c(=O)c3c2)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-13-21-18-9-6-15(12-17(18)19(23)22(13)3)14-4-7-16(8-5-14)24-11-10-20-2/h4-9,12,20H,10-11H2,1-3H3 |
| InChIKey | HNTBOWXRCKPRBN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|