C28H30N4O2 — CID 11669670
2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-6-pyridin-4-ylquinazolin-4-one (PubChem CID 11669670) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-6-pyridin-4-ylquinazolin-4-one.
| Compound Name | 2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-6-pyridin-4-ylquinazolin-4-one |
|---|---|
| PubChem CID | 11669670 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-6-pyridin-4-ylquinazolin-4-one |
| SMILES | Cc1nc2ccc(-c3ccncc3)cc2c(=O)n1-c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C28H30N4O2/c1-21-30-27-11-6-23(22-12-14-29-15-13-22)20-26(27)28(33)32(21)24-7-9-25(10-8-24)34-19-5-18-31-16-3-2-4-17-31/h6-15,20H,2-5,16-19H2,1H3 |
| InChIKey | IQLXQODFPMDMMW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|