C24H30N4O4S — CID 11547318
N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-6-yl]methanesulfonamide (PubChem CID 11547318) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-6-yl]methanesulfonamide.
| Compound Name | N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 11547318 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-6-yl]methanesulfonamide |
| SMILES | Cc1nc2ccc(NS(C)(=O)=O)cc2c(=O)n1-c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-18-25-23-12-7-19(26-33(2,30)31)17-22(23)24(29)28(18)20-8-10-21(11-9-20)32-16-6-15-27-13-4-3-5-14-27/h7-12,17,26H,3-6,13-16H2,1-2H3 |
| InChIKey | CJGXEDKBAZFAQB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|