C29H38N4O3 — CID 11576791
N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-7-yl]hexanamide (PubChem CID 11576791) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-7-yl]hexanamide.
| Compound Name | N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-7-yl]hexanamide |
|---|---|
| PubChem CID | 11576791 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-[2-methyl-4-oxo-3-[4-(3-piperidin-1-ylpropoxy)phenyl]quinazolin-7-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc2c(=O)n(-c3ccc(OCCCN4CCCCC4)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C29H38N4O3/c1-3-4-6-10-28(34)31-23-11-16-26-27(21-23)30-22(2)33(29(26)35)24-12-14-25(15-13-24)36-20-9-19-32-17-7-5-8-18-32/h11-16,21H,3-10,17-20H2,1-2H3,(H,31,34) |
| InChIKey | OQKHHWFLVJKHOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|