C28H45N7O5P+ — CID 10746525
[3-[2-[(E)-dimethylaminomethylideneamino]-6-phenylmethoxypurin-9-yl]-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium (PubChem CID 10746525) has the molecular formula C28H45N7O5P+ and a molecular weight of 590.69 g/mol. Its IUPAC name is [3-[2-[(E)-dimethylaminomethylideneamino]-6-phenylmethoxypurin-9-yl]-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium.
| Compound Name | [3-[2-[(E)-dimethylaminomethylideneamino]-6-phenylmethoxypurin-9-yl]-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 10746525 |
| Molecular Formula | C28H45N7O5P+ |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | [3-[2-[(E)-dimethylaminomethylideneamino]-6-phenylmethoxypurin-9-yl]-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium |
| SMILES | CC(C)OP(=O)(COC(Cn1cnc2c(OCc3ccccc3)nc(/N=C/N(C)C)nc21)C[N+](C)(C)C)OC(C)C |
| InChI | InChI=1S/C28H45N7O5P/c1-21(2)39-41(36,40-22(3)4)20-38-24(16-35(7,8)9)15-34-19-29-25-26(34)31-28(30-18-33(5)6)32-27(25)37-17-23-13-11-10-12-14-23/h10-14,18-19,21-22,24H,15-17,20H2,1-9H3/q+1/b30-18+ |
| InChIKey | PSNMIPZZPUCQBL-UXHLAJHPSA-N |
| XLogP | 4.72 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|