C17H20N2O6 — CID 160757175
[2-(2,4-dioxopyrimidin-1-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate (PubChem CID 160757175) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is [2-(2,4-dioxopyrimidin-1-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate.
| Compound Name | [2-(2,4-dioxopyrimidin-1-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate |
|---|---|
| PubChem CID | 160757175 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [2-(2,4-dioxopyrimidin-1-yl)-2-[(2R)-1-hydroxybutan-2-yl]oxyethyl] benzoate |
| SMILES | CC[C@H](CO)OC(COC(=O)c1ccccc1)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H20N2O6/c1-2-13(10-20)25-15(19-9-8-14(21)18-17(19)23)11-24-16(22)12-6-4-3-5-7-12/h3-9,13,15,20H,2,10-11H2,1H3,(H,18,21,23)/t13-,15?/m1/s1 |
| InChIKey | JRRHJAIRLZODLZ-AFYYWNPRSA-N |
| XLogP | 0.68 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |