C18H24ClN5O4 — CID 143411589
4-(6-aminopurin-9-yl)-2-methoxypentan-1-ol;(4-chlorophenyl)methanediol (PubChem CID 143411589) has the molecular formula C18H24ClN5O4 and a molecular weight of 409.87 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-methoxypentan-1-ol;(4-chlorophenyl)methanediol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-methoxypentan-1-ol;(4-chlorophenyl)methanediol |
|---|---|
| PubChem CID | 143411589 |
| Molecular Formula | C18H24ClN5O4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-methoxypentan-1-ol;(4-chlorophenyl)methanediol |
| SMILES | COC(CO)CC(C)n1cnc2c(N)ncnc21.OC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H17N5O2.C7H7ClO2/c1-7(3-8(4-17)18-2)16-6-15-9-10(12)13-5-14-11(9)16;8-6-3-1-5(2-4-6)7(9)10/h5-8,17H,3-4H2,1-2H3,(H2,12,13,14);1-4,7,9-10H |
| InChIKey | FDXXGLAZGQRNFV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|