C15H23N5O3 — CID 155409113
(2R,3R)-6-(6-aminopurin-9-yl)-2,3-dimethyloct-7-ene-1,4,5-triol (PubChem CID 155409113) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2R,3R)-6-(6-aminopurin-9-yl)-2,3-dimethyloct-7-ene-1,4,5-triol.
| Compound Name | (2R,3R)-6-(6-aminopurin-9-yl)-2,3-dimethyloct-7-ene-1,4,5-triol |
|---|---|
| PubChem CID | 155409113 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2R,3R)-6-(6-aminopurin-9-yl)-2,3-dimethyloct-7-ene-1,4,5-triol |
| SMILES | C=CC(C(O)C(O)[C@H](C)[C@@H](C)CO)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H23N5O3/c1-4-10(13(23)12(22)9(3)8(2)5-21)20-7-19-11-14(16)17-6-18-15(11)20/h4,6-10,12-13,21-23H,1,5H2,2-3H3,(H2,16,17,18)/t8-,9+,10?,12?,13?/m0/s1 |
| InChIKey | YVQUKKCZOLKVFE-HJOAWDGYSA-N |
| XLogP | 0.12 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|