C10H15KN5O10S2+ — CID 54611613
potassium 2-[1-(6-aminopurin-9-yl)-2-hydroxy-2-sulfoethoxy]-1,3-dihydroxypropane-1-sulfonic acid (PubChem CID 54611613) has the molecular formula C10H15KN5O10S2+ and a molecular weight of 468.49 g/mol. Its IUPAC name is potassium 2-[1-(6-aminopurin-9-yl)-2-hydroxy-2-sulfoethoxy]-1,3-dihydroxypropane-1-sulfonic acid.
| Compound Name | potassium 2-[1-(6-aminopurin-9-yl)-2-hydroxy-2-sulfoethoxy]-1,3-dihydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 54611613 |
| Molecular Formula | C10H15KN5O10S2+ |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | potassium 2-[1-(6-aminopurin-9-yl)-2-hydroxy-2-sulfoethoxy]-1,3-dihydroxypropane-1-sulfonic acid |
| SMILES | Nc1ncnc2c1ncn2C(OC(CO)C(O)S(=O)(=O)O)C(O)S(=O)(=O)O.[K+] |
| InChI | InChI=1S/C10H15N5O10S2.K/c11-6-5-7(13-2-12-6)15(3-14-5)8(10(18)27(22,23)24)25-4(1-16)9(17)26(19,20)21;/h2-4,8-10,16-18H,1H2,(H2,11,12,13)(H,19,20,21)(H,22,23,24);/q;+1 |
| InChIKey | NXFPIILIFVOREF-UHFFFAOYSA-N |
| XLogP | -6.30 |
| TPSA | 248.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | -6.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|