C13H22N5O6P — CID 173465381
[(3S)-3-[1-(6-aminopurin-9-yl)ethoxy]-1-hydroxypentan-2-yl] methyl hydrogen phosphate (PubChem CID 173465381) has the molecular formula C13H22N5O6P and a molecular weight of 375.32 g/mol. Its IUPAC name is [(3S)-3-[1-(6-aminopurin-9-yl)ethoxy]-1-hydroxypentan-2-yl] methyl hydrogen phosphate.
| Compound Name | [(3S)-3-[1-(6-aminopurin-9-yl)ethoxy]-1-hydroxypentan-2-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 173465381 |
| Molecular Formula | C13H22N5O6P |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(3S)-3-[1-(6-aminopurin-9-yl)ethoxy]-1-hydroxypentan-2-yl] methyl hydrogen phosphate |
| SMILES | CC[C@H](OC(C)n1cnc2c(N)ncnc21)C(CO)OP(=O)(O)OC |
| InChI | InChI=1S/C13H22N5O6P/c1-4-9(10(5-19)24-25(20,21)22-3)23-8(2)18-7-17-11-12(14)15-6-16-13(11)18/h6-10,19H,4-5H2,1-3H3,(H,20,21)(H2,14,15,16)/t8?,9-,10?/m0/s1 |
| InChIKey | XIVYQGDWVDCUHB-KYHHOPLUSA-N |
| XLogP | 0.85 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|