C21H27N5O — CID 10338866
9-[(2S,3R)-2-phenylmethoxynon-8-en-3-yl]purin-6-amine (PubChem CID 10338866) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 9-[(2S,3R)-2-phenylmethoxynon-8-en-3-yl]purin-6-amine.
| Compound Name | 9-[(2S,3R)-2-phenylmethoxynon-8-en-3-yl]purin-6-amine |
|---|---|
| PubChem CID | 10338866 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 9-[(2S,3R)-2-phenylmethoxynon-8-en-3-yl]purin-6-amine |
| SMILES | C=CCCCC[C@H]([C@H](C)OCc1ccccc1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H27N5O/c1-3-4-5-9-12-18(16(2)27-13-17-10-7-6-8-11-17)26-15-25-19-20(22)23-14-24-21(19)26/h3,6-8,10-11,14-16,18H,1,4-5,9,12-13H2,2H3,(H2,22,23,24)/t16-,18+/m0/s1 |
| InChIKey | HJXOCDVRZPXCBN-FUHWJXTLSA-N |
| XLogP | 4.30 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|