C12H16N5O4P — CID 155023162
(2R,3R)-2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-(phosphorosomethoxymethyl)oxolan-3-ol (PubChem CID 155023162) has the molecular formula C12H16N5O4P and a molecular weight of 325.27 g/mol. Its IUPAC name is (2R,3R)-2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-(phosphorosomethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R)-2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-(phosphorosomethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 155023162 |
| Molecular Formula | C12H16N5O4P |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (2R,3R)-2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-(phosphorosomethoxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1cnn2C[C@H]1OC(COCP=O)C[C@H]1O |
| InChI | InChI=1S/C12H16N5O4P/c13-11-8-2-16-17(12(8)15-5-14-11)3-10-9(18)1-7(21-10)4-20-6-22-19/h2,5,7,9-10,18H,1,3-4,6H2,(H2,13,14,15)/t7?,9-,10-/m1/s1 |
| InChIKey | VBHJPYSXZVJFLR-RWBYNWAKSA-N |
| XLogP | 0.19 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|