C11H19N5O7P+ — CID 90731858
2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-3-ium-9-yl]ethoxymethylphosphonic acid (PubChem CID 90731858) has the molecular formula C11H19N5O7P+ and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-3-ium-9-yl]ethoxymethylphosphonic acid.
| Compound Name | 2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-3-ium-9-yl]ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 90731858 |
| Molecular Formula | C11H19N5O7P+ |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-3-ium-9-yl]ethoxymethylphosphonic acid |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(CCOCP(=O)(O)O)c2[nH+]1 |
| InChI | InChI=1S/C11H18N5O7P/c1-21-4-5-23-10-14-8(12)7-9(15-10)16(11(17)13-7)2-3-22-6-24(18,19)20/h2-6H2,1H3,(H,13,17)(H2,12,14,15)(H2,18,19,20)/p+1 |
| InChIKey | SJXZQPBUHNWSOA-UHFFFAOYSA-O |
| XLogP | -1.70 |
| TPSA | 176.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|