C8H14N5O4P — CID 59986346
2-(6-amino-3,6-dihydropurin-9-yl)ethoxymethylphosphonic acid (PubChem CID 59986346) has the molecular formula C8H14N5O4P and a molecular weight of 275.20 g/mol. Its IUPAC name is 2-(6-amino-3,6-dihydropurin-9-yl)ethoxymethylphosphonic acid.
| Compound Name | 2-(6-amino-3,6-dihydropurin-9-yl)ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 59986346 |
| Molecular Formula | C8H14N5O4P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(6-amino-3,6-dihydropurin-9-yl)ethoxymethylphosphonic acid |
| SMILES | NC1N=CNc2c1ncn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C8H14N5O4P/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-17-5-18(14,15)16/h3-4,7H,1-2,5,9H2,(H,10,11)(H2,14,15,16) |
| InChIKey | LFOIFXUWRDFQIZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|