C10H16N5O6P — CID 174083697
[(2S,5R)-5-(6-amino-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl hydroxy hydrogen phosphate (PubChem CID 174083697) has the molecular formula C10H16N5O6P and a molecular weight of 333.24 g/mol. Its IUPAC name is [(2S,5R)-5-(6-amino-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl hydroxy hydrogen phosphate.
| Compound Name | [(2S,5R)-5-(6-amino-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl hydroxy hydrogen phosphate |
|---|---|
| PubChem CID | 174083697 |
| Molecular Formula | C10H16N5O6P |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [(2S,5R)-5-(6-amino-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl hydroxy hydrogen phosphate |
| SMILES | NC1N=CNc2c1ncn2[C@H]1CC[C@@H](COP(=O)(O)OO)O1 |
| InChI | InChI=1S/C10H16N5O6P/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(20-7)3-19-22(17,18)21-16/h4-7,9,16H,1-3,11H2,(H,12,13)(H,17,18)/t6-,7+,9?/m0/s1 |
| InChIKey | UQSQWDMXEDTQMU-PMDVUHRTSA-N |
| XLogP | 0.58 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|