About [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol
[5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 175806111) has the molecular formula C10H14N6O4
and a molecular weight of 282.26 g/mol. Its IUPAC name is [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol |
| PubChem CID | 175806111 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | NC1N=C([N+](=O)[O-])Nc2c1ncn2C1CCC(CO)O1 |
| InChI | InChI=1S/C10H14N6O4/c11-8-7-9(14-10(13-8)16(18)19)15(4-12-7)6-2-1-5(3-17)20-6/h4-6,8,17H,1-3,11H2,(H,13,14) |
| InChIKey | KGHOUYKTFWQSQP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol?
The IUPAC name of [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol (CID 175806111) is [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol.
What is the SMILES notation for [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol?
The canonical SMILES for [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol is NC1N=C([N+](=O)[O-])Nc2c1ncn2C1CCC(CO)O1.
What is the InChIKey of [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol?
The InChIKey is KGHOUYKTFWQSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O4/c11-8-7-9(14-10(13-8)16(18)19)15(4-12-7)6-2-1-5(3-17)20-6/h4-6,8,17H,1-3,11H2,(H,13,14).
What are the key properties of [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol?
[5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol has a molecular weight of 282.26 g/mol, XLogP of -0.43, 2 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(6-amino-2-nitro-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol is sourced from PubChem (CID 175806111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).