C11H14N4O2 — CID 14630171
[5-(4-aminoimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methanol (PubChem CID 14630171) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is [5-(4-aminoimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methanol.
| Compound Name | [5-(4-aminoimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 14630171 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [5-(4-aminoimidazo[4,5-c]pyridin-1-yl)oxolan-2-yl]methanol |
| SMILES | Nc1nccc2c1ncn2C1CCC(CO)O1 |
| InChI | InChI=1S/C11H14N4O2/c12-11-10-8(3-4-13-11)15(6-14-10)9-2-1-7(5-16)17-9/h3-4,6-7,9,16H,1-2,5H2,(H2,12,13) |
| InChIKey | DDDORMSWHUXEPZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |