C10H16N6O2 — CID 59986347
[5-(2,6-diamino-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 59986347) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is [5-(2,6-diamino-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [5-(2,6-diamino-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59986347 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [5-(2,6-diamino-3,6-dihydropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | NC1=NC(N)c2ncn(C3CCC(CO)O3)c2N1 |
| InChI | InChI=1S/C10H16N6O2/c11-8-7-9(15-10(12)14-8)16(4-13-7)6-2-1-5(3-17)18-6/h4-6,8,17H,1-3,11H2,(H3,12,14,15) |
| InChIKey | RBSDMNVFKVVRKO-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |