C13H15N2O5PS — CID 166670310
3-[(2R,5S)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]quinazolin-4-one (PubChem CID 166670310) has the molecular formula C13H15N2O5PS and a molecular weight of 342.31 g/mol. Its IUPAC name is 3-[(2R,5S)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]quinazolin-4-one.
| Compound Name | 3-[(2R,5S)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 166670310 |
| Molecular Formula | C13H15N2O5PS |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-[(2R,5S)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1[C@H]1CC[C@@H](COP(O)(O)=S)O1 |
| InChI | InChI=1S/C13H15N2O5PS/c16-13-10-3-1-2-4-11(10)14-8-15(13)12-6-5-9(20-12)7-19-21(17,18)22/h1-4,8-9,12H,5-7H2,(H2,17,18,22)/t9-,12+/m0/s1 |
| InChIKey | DXNSOFMMCVTGGD-JOYOIKCWSA-N |
| XLogP | 1.30 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|