C22H25N7O10P2S2 — CID 146517292
[(2R,3R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-3-hydroxy-5-(4-oxoquinazolin-3-yl)oxolan-2-yl]methoxy-sulfanylphosphinic acid (PubChem CID 146517292) has the molecular formula C22H25N7O10P2S2 and a molecular weight of 673.56 g/mol. Its IUPAC name is [(2R,3R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-3-hydroxy-5-(4-oxoquinazolin-3-yl)oxolan-2-yl]methoxy-sulfanylphosphinic acid.
| Compound Name | [(2R,3R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-3-hydroxy-5-(4-oxoquinazolin-3-yl)oxolan-2-yl]methoxy-sulfanylphosphinic acid |
|---|---|
| PubChem CID | 146517292 |
| Molecular Formula | C22H25N7O10P2S2 |
| Molecular Weight | 673.56 g/mol |
| Exact Mass | 673.06 |
| IUPAC Name | [(2R,3R,5R)-4-[[(2R,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]oxy-hydroxyphosphinothioyl]oxy-3-hydroxy-5-(4-oxoquinazolin-3-yl)oxolan-2-yl]methoxy-sulfanylphosphinic acid |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H](OP(O)(=S)OC2[C@H](n3cnc4ccccc4c3=O)O[C@H](COP(=O)(O)S)[C@H]2O)O1 |
| InChI | InChI=1S/C22H25N7O10P2S2/c23-19-16-20(25-8-24-19)28(10-27-16)14-5-6-15(37-14)38-41(34,43)39-18-17(30)13(7-35-40(32,33)42)36-22(18)29-9-26-12-4-2-1-3-11(12)21(29)31/h1-4,8-10,13-15,17-18,22,30H,5-7H2,(H,34,43)(H2,23,24,25)(H2,32,33,42)/t13-,14-,15-,17-,18?,22-,41?/m1/s1 |
| InChIKey | LVZLNQNQRCYTSP-ITISAVRESA-N |
| XLogP | 1.38 |
| TPSA | 228.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|