C28H27N3O2 — CID 121021700
3-[1-(3,3-diphenylpropanoyl)piperidin-3-yl]quinazolin-4-one (PubChem CID 121021700) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[1-(3,3-diphenylpropanoyl)piperidin-3-yl]quinazolin-4-one.
| Compound Name | 3-[1-(3,3-diphenylpropanoyl)piperidin-3-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 121021700 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[1-(3,3-diphenylpropanoyl)piperidin-3-yl]quinazolin-4-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CCCC(n2cnc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C28H27N3O2/c32-27(18-25(21-10-3-1-4-11-21)22-12-5-2-6-13-22)30-17-9-14-23(19-30)31-20-29-26-16-8-7-15-24(26)28(31)33/h1-8,10-13,15-16,20,23,25H,9,14,17-19H2 |
| InChIKey | RAJZAKFKPYUBDV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |