C15H20N3O6P — CID 166670156
[(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 166670156) has the molecular formula C15H20N3O6P and a molecular weight of 369.31 g/mol. Its IUPAC name is [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 166670156 |
| Molecular Formula | C15H20N3O6P |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[C@@H]1CC[C@H](n2cnc3cccc(CN)c3c2=O)O1 |
| InChI | InChI=1S/C15H20N3O6P/c1-22-25(20,21)23-8-11-5-6-13(24-11)18-9-17-12-4-2-3-10(7-16)14(12)15(18)19/h2-4,9,11,13H,5-8,16H2,1H3,(H,20,21)/t11-,13+/m0/s1 |
| InChIKey | JQGSZSVFPDFIPN-WCQYABFASA-N |
| XLogP | 1.30 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|