About [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate
[(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 166670156) has the molecular formula C15H20N3O6P
and a molecular weight of 369.31 g/mol. Its IUPAC name is [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate.
Molecular Properties
| Compound Name | [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate |
| PubChem CID | 166670156 |
| Molecular Formula | C15H20N3O6P |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[C@@H]1CC[C@H](n2cnc3cccc(CN)c3c2=O)O1 |
| InChI | InChI=1S/C15H20N3O6P/c1-22-25(20,21)23-8-11-5-6-13(24-11)18-9-17-12-4-2-3-10(7-16)14(12)15(18)19/h2-4,9,11,13H,5-8,16H2,1H3,(H,20,21)/t11-,13+/m0/s1 |
| InChIKey | JQGSZSVFPDFIPN-WCQYABFASA-N |
| XLogP | 1.30 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate?
The IUPAC name of [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate (CID 166670156) is [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate.
What is the SMILES notation for [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate?
The canonical SMILES for [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate is COP(=O)(O)OC[C@@H]1CC[C@H](n2cnc3cccc(CN)c3c2=O)O1.
What is the InChIKey of [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate?
The InChIKey is JQGSZSVFPDFIPN-WCQYABFASA-N. The full InChI is InChI=1S/C15H20N3O6P/c1-22-25(20,21)23-8-11-5-6-13(24-11)18-9-17-12-4-2-3-10(7-16)14(12)15(18)19/h2-4,9,11,13H,5-8,16H2,1H3,(H,20,21)/t11-,13+/m0/s1.
What are the key properties of [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate?
[(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate has a molecular weight of 369.31 g/mol, XLogP of 1.30, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-[5-(aminomethyl)-4-oxoquinazolin-3-yl]oxolan-2-yl]methyl methyl hydrogen phosphate is sourced from PubChem (CID 166670156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).