C14H22N5O7P — CID 24899195
[2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]cyclopentyl]oxymethylphosphonic acid (PubChem CID 24899195) has the molecular formula C14H22N5O7P and a molecular weight of 403.33 g/mol. Its IUPAC name is [2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]cyclopentyl]oxymethylphosphonic acid.
| Compound Name | [2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]cyclopentyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 24899195 |
| Molecular Formula | C14H22N5O7P |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [2-[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]cyclopentyl]oxymethylphosphonic acid |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(C3CCCC3OCP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C14H22N5O7P/c1-24-5-6-25-13-17-11(15)10-12(18-13)19(14(20)16-10)8-3-2-4-9(8)26-7-27(21,22)23/h8-9H,2-7H2,1H3,(H,16,20)(H2,15,17,18)(H2,21,22,23) |
| InChIKey | HQQGGBCJOVCIJF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|