C10H13N5O — CID 10632666
2-(6-aminopurin-7-yl)pent-4-en-1-ol (PubChem CID 10632666) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-(6-aminopurin-7-yl)pent-4-en-1-ol.
| Compound Name | 2-(6-aminopurin-7-yl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 10632666 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-(6-aminopurin-7-yl)pent-4-en-1-ol |
| SMILES | C=CCC(CO)n1cnc2ncnc(N)c21 |
| InChI | InChI=1S/C10H13N5O/c1-2-3-7(4-16)15-6-14-10-8(15)9(11)12-5-13-10/h2,5-7,16H,1,3-4H2,(H2,11,12,13) |
| InChIKey | POVXIEFYGGYAIP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|