C10H18N5O11P3 — CID 11713063
[2-(6-aminopurin-7-yl)-4-hydroxybutoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 11713063) has the molecular formula C10H18N5O11P3 and a molecular weight of 477.20 g/mol. Its IUPAC name is [2-(6-aminopurin-7-yl)-4-hydroxybutoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [2-(6-aminopurin-7-yl)-4-hydroxybutoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 11713063 |
| Molecular Formula | C10H18N5O11P3 |
| Molecular Weight | 477.20 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | [2-(6-aminopurin-7-yl)-4-hydroxybutoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | Nc1ncnc2ncn(C(CCO)COCP(=O)(O)OP(=O)(O)OP(=O)(O)O)c12 |
| InChI | InChI=1S/C10H18N5O11P3/c11-9-8-10(13-4-12-9)14-5-15(8)7(1-2-16)3-24-6-27(17,18)25-29(22,23)26-28(19,20)21/h4-5,7,16H,1-3,6H2,(H,17,18)(H,22,23)(H2,11,12,13)(H2,19,20,21) |
| InChIKey | GIONJSGFAXEEGE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 249.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|