C11H16N5O12P3 — CID 16728931
[(1S,3R,4R,7S)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 16728931) has the molecular formula C11H16N5O12P3 and a molecular weight of 503.19 g/mol. Its IUPAC name is [(1S,3R,4R,7S)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [(1S,3R,4R,7S)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 16728931 |
| Molecular Formula | C11H16N5O12P3 |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | [(1S,3R,4R,7S)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-7-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H]2CO[C@@H]1[C@H]2OCP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H16N5O12P3/c12-9-6-10(14-2-13-9)16(3-15-6)11-8-7(5(26-11)1-24-8)25-4-29(17,18)27-31(22,23)28-30(19,20)21/h2-3,5,7-8,11H,1,4H2,(H,17,18)(H,22,23)(H2,12,13,14)(H2,19,20,21)/t5-,7-,8+,11+/m0/s1 |
| InChIKey | KWCKGTSQJXDGSK-WOIOKPISSA-N |
| XLogP | -0.54 |
| TPSA | 247.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|