C27H37N4O9PS — CID 87775815
[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxy-[[4-hydroxy-3-[6-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)purin-9-yl]butoxy]methyl]phosphinic acid (PubChem CID 87775815) has the molecular formula C27H37N4O9PS and a molecular weight of 624.65 g/mol. Its IUPAC name is [1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxy-[[4-hydroxy-3-[6-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)purin-9-yl]butoxy]methyl]phosphinic acid.
| Compound Name | [1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxy-[[4-hydroxy-3-[6-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)purin-9-yl]butoxy]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87775815 |
| Molecular Formula | C27H37N4O9PS |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | [1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]oxy-[[4-hydroxy-3-[6-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)purin-9-yl]butoxy]methyl]phosphinic acid |
| SMILES | CC(C)(C)OC(=O)C(OP(=O)(O)COCCC(CO)n1cnc2c(C3=CC(=S)CC=C3)ncnc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H37N4O9PS/c1-26(2,3)38-24(33)22(25(34)39-27(4,5)6)40-41(35,36)16-37-11-10-18(13-32)31-15-30-21-20(28-14-29-23(21)31)17-8-7-9-19(42)12-17/h7-8,12,14-15,18,22,32H,9-11,13,16H2,1-6H3,(H,35,36) |
| InChIKey | YBRODWYNKOAUDL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 172.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|