C20H27ClN4O4 — CID 141386995
ditert-butyl 2-[2-(6-chloropurin-9-yl)but-3-enyl]propanedioate (PubChem CID 141386995) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is ditert-butyl 2-[2-(6-chloropurin-9-yl)but-3-enyl]propanedioate.
| Compound Name | ditert-butyl 2-[2-(6-chloropurin-9-yl)but-3-enyl]propanedioate |
|---|---|
| PubChem CID | 141386995 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | ditert-butyl 2-[2-(6-chloropurin-9-yl)but-3-enyl]propanedioate |
| SMILES | C=CC(CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C20H27ClN4O4/c1-8-12(25-11-24-14-15(21)22-10-23-16(14)25)9-13(17(26)28-19(2,3)4)18(27)29-20(5,6)7/h8,10-13H,1,9H2,2-7H3 |
| InChIKey | QBQJSWBKAZTHRF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|