C16H14ClN5O2 — CID 135001309
N-[3-(6-chloropurin-9-yl)butanoyl]benzamide (PubChem CID 135001309) has the molecular formula C16H14ClN5O2 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-[3-(6-chloropurin-9-yl)butanoyl]benzamide.
| Compound Name | N-[3-(6-chloropurin-9-yl)butanoyl]benzamide |
|---|---|
| PubChem CID | 135001309 |
| Molecular Formula | C16H14ClN5O2 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[3-(6-chloropurin-9-yl)butanoyl]benzamide |
| SMILES | CC(CC(=O)NC(=O)c1ccccc1)n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C16H14ClN5O2/c1-10(22-9-20-13-14(17)18-8-19-15(13)22)7-12(23)21-16(24)11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3,(H,21,23,24) |
| InChIKey | RVTDSSBMSQRGOW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |