C11H14ClFN4O3 — CID 89211723
(2R)-2-[1-(6-chloropurin-9-yl)ethoxy]-4-fluorobutane-1,3-diol (PubChem CID 89211723) has the molecular formula C11H14ClFN4O3 and a molecular weight of 304.71 g/mol. Its IUPAC name is (2R)-2-[1-(6-chloropurin-9-yl)ethoxy]-4-fluorobutane-1,3-diol.
| Compound Name | (2R)-2-[1-(6-chloropurin-9-yl)ethoxy]-4-fluorobutane-1,3-diol |
|---|---|
| PubChem CID | 89211723 |
| Molecular Formula | C11H14ClFN4O3 |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2R)-2-[1-(6-chloropurin-9-yl)ethoxy]-4-fluorobutane-1,3-diol |
| SMILES | CC(O[C@H](CO)C(O)CF)n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C11H14ClFN4O3/c1-6(20-8(3-18)7(19)2-13)17-5-16-9-10(12)14-4-15-11(9)17/h4-8,18-19H,2-3H2,1H3/t6?,7?,8-/m1/s1 |
| InChIKey | LOWMZDKSVHRVIN-KAVNDROISA-N |
| XLogP | 0.71 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |